![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Zerina Bosovic _ Phenomenon of Trafficking in Human Beings in Montenegro.ppt | 2024-11-15 14:37 | 459K | |
| Vesna Radović, Darinka Joksimović _ Dragana Petrušić _Light physical injury.ppt | 2024-11-15 14:37 | 1.1M | |
| Terek Dijana, Dizdarević Adela _ Prevention of domestic violence.ppt | 2024-11-15 14:37 | 269K | |
| Stanišić Kristina, Radinović Nevena, Fuštić Milica _ Euthanasia as a criminal act.ppt | 2024-11-15 14:37 | 971K | |
| Slaviša Samardžić _ Safety at sports events.ppt | 2024-11-15 14:37 | 1.8M | |
| Rajković Sanja, Brajović Marija _ Violent behaviour at sports events and public gathering.ppt | 2024-11-15 14:37 | 1.2M | |
| Petar Raskovic, Kneyevic Stevo _ Corruption.ppt | 2024-11-15 14:37 | 6.3M | |
| Pavle Velimirović, Racković Marija _ DOMESTIC VIOLENCE_ PROBLEM SOLVING.ppt | 2024-11-15 14:37 | 490K | |
![[ ]](/icons/layout.gif) | Novák_Security Policy and Crime Prevention in the Czech Republic.pdf | 2024-11-15 14:37 | 595K | |
| Nikolina Tomovic_ ORGANISED CRIME AND TERRORISM IN MONTENEGRO.ppt | 2024-11-15 14:37 | 11M | |
| Nikola Pejovic Masa Cupic _Crime prevention through community empowerment.ppt | 2024-11-15 14:37 | 1.7M | |
| Nikola Gogic _ SERIAL KILLERS.ppt | 2024-11-15 14:37 | 1.5M | |
| Nadja Cejovic and Lidija Vukotic _ Human Trafficking.ppt | 2024-11-15 14:37 | 1.5M | |
| Mitrović Vladana, Lljuljić Nikoleta _ THE MURDER OF A CHILD AT CHILDBIRTH _INFANTICIDE_.ppt | 2024-11-15 14:37 | 4.3M | |
| Milana Savović, Jelena Bulajić _ Rape as a form of criminal offense against sexual freedom.ppt | 2024-11-15 14:37 | 1.1M | |
| Megan Smith_Scottish Security in Localised and Community Settings Organisation and Regulation.pdf | 2024-11-15 14:37 | 661K | |
| Marresa Pavuna_Portuguese Strategies to Keep the Local Community Safe.pdf | 2024-11-15 14:37 | 1.2M | |
| Marko Nedovic, Marko Vukovic _ Violent Murder.ppt | 2024-11-15 14:37 | 2.4M | |
| Marko Kaluža_Police Officers_ Perspectives on Migrations as a Security Threat.pdf | 2024-11-15 14:37 | 1.1M | |
| Maja Mijovic Marija Blazevic_ Ignorantia juris non excusat.ppt | 2024-11-15 14:37 | 1.7M | |
| Magdalena Sljivic _ Security of computer data.ppt | 2024-11-15 14:37 | 1.0M | |
| Maša Pajović, Medenica Andrea _ Cybercrime.ppt | 2024-11-15 14:37 | 600K | |
| Ksenija Moracanin, Marija markovic _ DOMESTIC VIOLENCE.ppt | 2024-11-15 14:37 | 1.1M | |
| Jovanović Lela, Čabarkapa Milena _ Genocide.ppt | 2024-11-15 14:37 | 2.1M | |
| Jovana Lečić _ Ecological problem and pollution in MNE.ppt | 2024-11-15 14:37 | 572K | |
| Jelena Tomašević _ Jovana Rašović _ Targeted surveillance.ppt | 2024-11-15 14:37 | 1.6M | |
| Jelena Otovic, Andjelija Otovic _ Domestic Violence.ppt | 2024-11-15 14:37 | 1.5M | |
| Jela Jokanović _ Terrorism a crime against humanity In the aspects of law.ppt | 2024-11-15 14:37 | 3.1M | |
| Jasna Lalević _ PREVENTION OF HUMAN TRAFFICKING.ppt | 2024-11-15 14:37 | 3.2M | |
| Izabela Kordic, Ivana Bulatovic, Ljubica Smolovic, Teodora Popovic _ Piracy _1_.ppt | 2024-11-15 14:37 | 2.0M | |
| Ivona Gojković, Milica Kopitović, Marko Ašanin – Genocide _ PeRSECUTION OF THE JEWS.ppt | 2024-11-15 14:37 | 782K | |
| Ivana Maraš_Narcotics and juveniles.ppt | 2024-11-15 14:37 | 575K | |
| Iva Rolović _ SOCIAL DEVIATIONS.ppt | 2024-11-15 14:37 | 1.7M | |
| Gorović Teodora, Globarević Milena _ DRUG_RELATED CRIME.ppt | 2024-11-15 14:37 | 4.4M | |
| Filip Golubovic, Meris Mujevic _ Road traffic safety.ppt | 2024-11-15 14:37 | 1.6M | |
| Eva Blatnik N Gabersek_the introduction of research project.pdf | 2024-11-15 14:37 | 261K | |
| Ester Doljak, Katrin Podgorski_Police officers_ perspectives on street crime in Slovenia.pdf | 2024-11-15 14:37 | 434K | |
| Dejana Drljevic _ Drugs and criminal organisations_ two main causes of endangered security.ppt | 2024-11-15 14:37 | 1.0M | |
| Damir Suljević _ Personal data protection.ppt | 2024-11-15 14:37 | 106K | |
| Bokan Dragana _ BULLYING AND VIOLENCE.ppt | 2024-11-15 14:37 | 430K | |
| Azra Sukurica _ Illegal termination of pregnancy.ppt | 2024-11-15 14:37 | 637K | |
| Anja Kapla_Police officers _ perspectives on alcohol and drug related offences in Slovenia.pdf | 2024-11-15 14:37 | 415K | |
| Andrej Bračko_Police officers_ perspectives on environmental crime.pdf | 2024-11-15 14:37 | 726K | |
| Andjela Milickovic _ Security and self_defense as a school subject.ppt | 2024-11-15 14:37 | 2.8M | |
| Ana Novak, Eva Završnik _Police officers _ perspectives on social cohesion in the neighbourhood.pdf | 2024-11-15 14:37 | 893K | |
| Aleksandar Lelević _ Food safety.pdf | 2024-11-15 14:37 | 1.0M | |
| Adam Dunphy Scottish security in localised and community.pdf | 2024-11-15 14:37 | 697K | |
| 3rd International Student Conference.docx | 2024-11-15 14:37 | 20K | |
|
|---|